 Click image to view full size image |
|
| Product: |
Views:1712,6-Difluorobenzoic acid |
| Unit price: |
Negotiable |
| MOQ: |
|
| Quantity: |
|
| Delivery date: |
Since the payment date Days delivery |
| Valid until: |
Long-term effective |
| Last updated: |
2017-08-05 19:48 |
| |
 |
|
2,6-Difluorobenzoic acid
| Category: |
Intermediates |
|
| CAS NO: |
385-00-2 |
| EC NO: |
206-856-3 |
| Molecular Formula: |
C7H3F2O2
|
| Molecular Weight: |
157.0949 |
| Specification: |
|
| InChI: |
InChI=1/C7H4F2O2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11)/p-1 |
| Synonyms: |
Difluorobenzoicacid;2,6-difluorobenzoate; |
| Molecular Structure: |
 |
|
